"Properties of Salt" Salt PPT Courseware 2

Description

"Properties of Salt" Salt PPT Courseware 2

Knowledge review

Knowledge point 1 Properties of salt

1. Salt can be regarded as a product of __________, but there are many more types of salt than acids and bases.

2. Properties of salt:

(1) Most salts are ______ at room temperature, and their melting points are ______.

(2) Many salts are _____ soluble in water, such as potassium salts, sodium salts, ammonium salts and nitrates; there are also many salts _____ soluble in water, such as most carbonates.

(3) The properties of salts are generally _______ than those of corresponding acids and bases, so salts are easy to separate and purify from mixtures, and are easier to store, transport and measure.

(4) Two salts react to form two other salts, usually at least one of which is _________, such as the reaction between sodium chloride solution and silver nitrate solution_______________.

(5) Some salts are difficult to dissolve in water but soluble in acid and react, such as ________; while some salts such as AgCl, BaSO4, etc. are both difficult to dissolve in water and _____ soluble in acid.

Summary of chemical properties of salt:

(1) Salt + acid → new salt + new acid HCl+AgNO3==AgCl↓+HNO3

(2) Salt + alkali → new salt + new alkali Cu(OH)2+2HNO3==Cu(NO3)2+2H2O

(3) Salt 1 + Salt 2 → New Salt 1 + New Salt 2 AgNO3 +NaCl==AgCl↓+NaNO3

The conditions for the above three reactions to occur: there is gas or water or precipitation in the product

(4) Salt + metal → new salt + new metal Zn+CuSO4 ==ZnSO4+Cu

Conditions for this reaction to occur: The metal is chemically more active than the new metal

Knowledge point 2: Metathesis reaction and the conditions for its occurrence

metathesis reaction

(1) Definition: A reaction in which two compounds react with each other to form two other compounds.

(2) Conditions for occurrence (the following are sufficient): a.__________; b.__________; c.__________.

(3) Write the chemical equation for the reaction between copper sulfate and sodium hydroxide: ____________________, there is _______ in the reactants, which is a metathesis reaction

Example analysis

►Type 1 Properties of salt

Propositional perspective: Test students’ understanding of the properties of salt.

Example 1 Among the following statements about the properties of salt, which one is wrong ( )

A. Salt solutions are neutral

B. Dilute hydrochloric acid can be used to test carbonate

C. Both nitrates are soluble in water

D. Ammonium salt can react with alkali to release ammonia gas

【Analysis】

A. Not all salt solutions are neutral. For example, sodium carbonate solution is alkaline, which is wrong;

B. Dilute hydrochloric acid can be used to test carbonate, correct;

C. All nitrates are soluble in water, correct;

D. Ammonium salt can react with alkali to release ammonia gas, correct;

Therefore choose A.

►Type 2 Metathesis reaction

Propositional perspective: Test students’ understanding of the definition of metathesis reaction and the conditions for its occurrence.

Example 2: Which of the following chemical equations belongs to the metathesis reaction ( )

A． C + O2 === CO2

B． H2CO3 === H2O + CO2↑

C. H2 + CuO === Cu + H2O

D. HCl + AgNO3 === AgCl↓ + HNO3

[Analysis] A. A reaction that produces one substance from the reaction of two or more substances is a chemical reaction, so A is wrong;

B. A reaction in which one substance produces two or more substances is a decomposition reaction, so B is wrong;

C. The reaction of an element and a compound to form another element and compound is a displacement reaction, so B is wrong;

D. The reaction in which two compounds exchange components with each other to generate two other compounds is a metathesis reaction, so D is correct;

So choose D.

Keywords: Salt teaching courseware, Salt properties teaching courseware, Beijing curriculum reform version 9th grade chemistry PPT courseware download, Volume 2 chemistry download, 9th grade chemistry slide courseware download, Salt PPT courseware download, Salt properties PPT courseware download, .PPT format;

For more information about the "Properties of Salt" PPT courseware, please click on the "Salt ppt Properties of Salt ppt" tag.

"Properties of Salt" Salt PPT Courseware:

"Properties of Salt" Salt PPT Courseware 1. Physical properties of salt: Solubility 1. Write down the common salts that are insoluble in water: (1). Hydrochloride _____; (2). Sulfate _____; (3) ).Carbonate _____. _______; (4).Alkali _______ . ________ . 2. write..

File Info

Update Time: 2024-07-05

This template belongs to Chemistry courseware Beijing Curriculum Reform Edition Ninth Grade Chemistry Volume 2 industry PPT template

Preview